C19H38N2O8 — CID 122627342
(3R,5R,6R)-2-amino-3-[[(3S,4R)-4,5-dimethoxy-2-methyloxan-3-yl]amino]-6-(hydroxymethyl)-4,5-dimethoxy-1-(methoxymethyl)cyclohexan-1-ol (PubChem CID 122627342) has the molecular formula C19H38N2O8 and a molecular weight of 422.52 g/mol. Its IUPAC name is (3R,5R,6R)-2-amino-3-[[(3S,4R)-4,5-dimethoxy-2-methyloxan-3-yl]amino]-6-(hydroxymethyl)-4,5-dimethoxy-1-(methoxymethyl)cyclohexan-1-ol.
| Compound Name | (3R,5R,6R)-2-amino-3-[[(3S,4R)-4,5-dimethoxy-2-methyloxan-3-yl]amino]-6-(hydroxymethyl)-4,5-dimethoxy-1-(methoxymethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 122627342 |
| Molecular Formula | C19H38N2O8 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | (3R,5R,6R)-2-amino-3-[[(3S,4R)-4,5-dimethoxy-2-methyloxan-3-yl]amino]-6-(hydroxymethyl)-4,5-dimethoxy-1-(methoxymethyl)cyclohexan-1-ol |
| SMILES | COCC1(O)C(N)[C@@H](N[C@H]2C(C)OCC(OC)[C@@H]2OC)C(OC)[C@H](OC)[C@H]1CO |
| InChI | InChI=1S/C19H38N2O8/c1-10-13(16(27-5)12(25-3)8-29-10)21-14-17(28-6)15(26-4)11(7-22)19(23,9-24-2)18(14)20/h10-18,21-23H,7-9,20H2,1-6H3/t10?,11-,12?,13+,14+,15-,16+,17?,18?,19?/m1/s1 |
| InChIKey | UIRNECQWMWXMBX-XTTZBZEMSA-N |
| XLogP | -1.88 |
| TPSA | 133.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |