About 2-(hydroxymethyl)-2,4,4-trimethylhexane-1-sulfinate
2-(hydroxymethyl)-2,4,4-trimethylhexane-1-sulfinate (PubChem CID 122627621) has the molecular formula C10H21O3S-
and a molecular weight of 221.34 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2,4,4-trimethylhexane-1-sulfinate.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-2,4,4-trimethylhexane-1-sulfinate |
| PubChem CID | 122627621 |
| Molecular Formula | C10H21O3S- |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-(hydroxymethyl)-2,4,4-trimethylhexane-1-sulfinate |
| SMILES | CCC(C)(C)CC(C)(CO)CS(=O)[O-] |
| InChI | InChI=1S/C10H22O3S/c1-5-9(2,3)6-10(4,7-11)8-14(12)13/h11H,5-8H2,1-4H3,(H,12,13)/p-1 |
| InChIKey | CNMQSTYETYIJMN-UHFFFAOYSA-M |
| XLogP | 1.69 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)-2,4,4-trimethylhexane-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-2,4,4-trimethylhexane-1-sulfinate?
The IUPAC name of 2-(hydroxymethyl)-2,4,4-trimethylhexane-1-sulfinate (CID 122627621) is 2-(hydroxymethyl)-2,4,4-trimethylhexane-1-sulfinate.
What is the SMILES notation for 2-(hydroxymethyl)-2,4,4-trimethylhexane-1-sulfinate?
The canonical SMILES for 2-(hydroxymethyl)-2,4,4-trimethylhexane-1-sulfinate is CCC(C)(C)CC(C)(CO)CS(=O)[O-].
What is the InChIKey of 2-(hydroxymethyl)-2,4,4-trimethylhexane-1-sulfinate?
The InChIKey is CNMQSTYETYIJMN-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H22O3S/c1-5-9(2,3)6-10(4,7-11)8-14(12)13/h11H,5-8H2,1-4H3,(H,12,13)/p-1.
What are the key properties of 2-(hydroxymethyl)-2,4,4-trimethylhexane-1-sulfinate?
2-(hydroxymethyl)-2,4,4-trimethylhexane-1-sulfinate has a molecular weight of 221.34 g/mol, XLogP of 1.69, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-2,4,4-trimethylhexane-1-sulfinate is sourced from PubChem (CID 122627621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).