About 2-(4-ethoxycyclohexa-1,3-dien-1-yl)acetaldehyde
2-(4-ethoxycyclohexa-1,3-dien-1-yl)acetaldehyde (PubChem CID 122628143) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-(4-ethoxycyclohexa-1,3-dien-1-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(4-ethoxycyclohexa-1,3-dien-1-yl)acetaldehyde |
| PubChem CID | 122628143 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2-(4-ethoxycyclohexa-1,3-dien-1-yl)acetaldehyde |
| SMILES | CCOC1=CC=C(CC=O)CC1 |
| InChI | InChI=1S/C10H14O2/c1-2-12-10-5-3-9(4-6-10)7-8-11/h3,5,8H,2,4,6-7H2,1H3 |
| InChIKey | NMXYSGMYVTUCRE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethoxycyclohexa-1,3-dien-1-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethoxycyclohexa-1,3-dien-1-yl)acetaldehyde?
The IUPAC name of 2-(4-ethoxycyclohexa-1,3-dien-1-yl)acetaldehyde (CID 122628143) is 2-(4-ethoxycyclohexa-1,3-dien-1-yl)acetaldehyde.
What is the SMILES notation for 2-(4-ethoxycyclohexa-1,3-dien-1-yl)acetaldehyde?
The canonical SMILES for 2-(4-ethoxycyclohexa-1,3-dien-1-yl)acetaldehyde is CCOC1=CC=C(CC=O)CC1.
What is the InChIKey of 2-(4-ethoxycyclohexa-1,3-dien-1-yl)acetaldehyde?
The InChIKey is NMXYSGMYVTUCRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-2-12-10-5-3-9(4-6-10)7-8-11/h3,5,8H,2,4,6-7H2,1H3.
What are the key properties of 2-(4-ethoxycyclohexa-1,3-dien-1-yl)acetaldehyde?
2-(4-ethoxycyclohexa-1,3-dien-1-yl)acetaldehyde has a molecular weight of 166.22 g/mol, XLogP of 2.22, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxycyclohexa-1,3-dien-1-yl)acetaldehyde is sourced from PubChem (CID 122628143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).