About 1-[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]-N,N-dimethylmethanamine
1-[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]-N,N-dimethylmethanamine (PubChem CID 122628208) has the molecular formula C9H17N3S
and a molecular weight of 199.32 g/mol. Its IUPAC name is 1-[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]-N,N-dimethylmethanamine |
| PubChem CID | 122628208 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 1-[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1csc(CN(C)C)n1 |
| InChI | InChI=1S/C9H17N3S/c1-11(2)5-8-7-13-9(10-8)6-12(3)4/h7H,5-6H2,1-4H3 |
| InChIKey | HLQIDNVAMYTYHO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]-N,N-dimethylmethanamine (CID 122628208) is 1-[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]-N,N-dimethylmethanamine is CN(C)Cc1csc(CN(C)C)n1.
What is the InChIKey of 1-[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]-N,N-dimethylmethanamine?
The InChIKey is HLQIDNVAMYTYHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3S/c1-11(2)5-8-7-13-9(10-8)6-12(3)4/h7H,5-6H2,1-4H3.
What are the key properties of 1-[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]-N,N-dimethylmethanamine?
1-[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]-N,N-dimethylmethanamine has a molecular weight of 199.32 g/mol, XLogP of 1.27, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(dimethylamino)methyl]-1,3-thiazol-4-yl]-N,N-dimethylmethanamine is sourced from PubChem (CID 122628208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).