C25H44N4 — CID 122628374
(3E,5Z,8E,10Z,13E)-3-N,8-N,13-N-triethyl-3-N,8-N,13-N-trimethylhexadeca-3,5,8,10,13,15-hexaene-2,3,8,13-tetramine (PubChem CID 122628374) has the molecular formula C25H44N4 and a molecular weight of 400.66 g/mol. Its IUPAC name is (3E,5Z,8E,10Z,13E)-3-N,8-N,13-N-triethyl-3-N,8-N,13-N-trimethylhexadeca-3,5,8,10,13,15-hexaene-2,3,8,13-tetramine.
| Compound Name | (3E,5Z,8E,10Z,13E)-3-N,8-N,13-N-triethyl-3-N,8-N,13-N-trimethylhexadeca-3,5,8,10,13,15-hexaene-2,3,8,13-tetramine |
|---|---|
| PubChem CID | 122628374 |
| Molecular Formula | C25H44N4 |
| Molecular Weight | 400.66 g/mol |
| Exact Mass | 400.36 |
| IUPAC Name | (3E,5Z,8E,10Z,13E)-3-N,8-N,13-N-triethyl-3-N,8-N,13-N-trimethylhexadeca-3,5,8,10,13,15-hexaene-2,3,8,13-tetramine |
| SMILES | C=C/C=C(\C/C=C\C=C(/C/C=C\C=C(/C(C)N)N(C)CC)N(C)CC)N(C)CC |
| InChI | InChI=1S/C25H44N4/c1-9-17-23(27(6)10-2)18-13-14-19-24(28(7)11-3)20-15-16-21-25(22(5)26)29(8)12-4/h9,13-17,19,21-22H,1,10-12,18,20,26H2,2-8H3/b14-13-,16-15-,23-17+,24-19+,25-21+ |
| InChIKey | UCJWJSHULVXUOW-YUGCOHDSSA-N |
| XLogP | 4.92 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.66 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|