About 4,5-dimethyl-N-(trifluoromethylsulfonyl)-1,3-thiazole-2-carboxamide
4,5-dimethyl-N-(trifluoromethylsulfonyl)-1,3-thiazole-2-carboxamide (PubChem CID 122628436) has the molecular formula C7H7F3N2O3S2
and a molecular weight of 288.27 g/mol. Its IUPAC name is 4,5-dimethyl-N-(trifluoromethylsulfonyl)-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 4,5-dimethyl-N-(trifluoromethylsulfonyl)-1,3-thiazole-2-carboxamide |
| PubChem CID | 122628436 |
| Molecular Formula | C7H7F3N2O3S2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 4,5-dimethyl-N-(trifluoromethylsulfonyl)-1,3-thiazole-2-carboxamide |
| SMILES | Cc1nc(C(=O)NS(=O)(=O)C(F)(F)F)sc1C |
| InChI | InChI=1S/C7H7F3N2O3S2/c1-3-4(2)16-6(11-3)5(13)12-17(14,15)7(8,9)10/h1-2H3,(H,12,13) |
| InChIKey | ZVMBNHWQOHAUKY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-dimethyl-N-(trifluoromethylsulfonyl)-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-N-(trifluoromethylsulfonyl)-1,3-thiazole-2-carboxamide?
The IUPAC name of 4,5-dimethyl-N-(trifluoromethylsulfonyl)-1,3-thiazole-2-carboxamide (CID 122628436) is 4,5-dimethyl-N-(trifluoromethylsulfonyl)-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 4,5-dimethyl-N-(trifluoromethylsulfonyl)-1,3-thiazole-2-carboxamide?
The canonical SMILES for 4,5-dimethyl-N-(trifluoromethylsulfonyl)-1,3-thiazole-2-carboxamide is Cc1nc(C(=O)NS(=O)(=O)C(F)(F)F)sc1C.
What is the InChIKey of 4,5-dimethyl-N-(trifluoromethylsulfonyl)-1,3-thiazole-2-carboxamide?
The InChIKey is ZVMBNHWQOHAUKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N2O3S2/c1-3-4(2)16-6(11-3)5(13)12-17(14,15)7(8,9)10/h1-2H3,(H,12,13).
What are the key properties of 4,5-dimethyl-N-(trifluoromethylsulfonyl)-1,3-thiazole-2-carboxamide?
4,5-dimethyl-N-(trifluoromethylsulfonyl)-1,3-thiazole-2-carboxamide has a molecular weight of 288.27 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-N-(trifluoromethylsulfonyl)-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 122628436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).