C38H24N4O — CID 122628767
2-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-4-phenyl-[1]benzofuro[2,3-d]pyrimidine (PubChem CID 122628767) has the molecular formula C38H24N4O and a molecular weight of 552.64 g/mol. Its IUPAC name is 2-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-4-phenyl-[1]benzofuro[2,3-d]pyrimidine.
| Compound Name | 2-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-4-phenyl-[1]benzofuro[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 122628767 |
| Molecular Formula | C38H24N4O |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 2-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-4-phenyl-[1]benzofuro[2,3-d]pyrimidine |
| SMILES | c1ccc(-c2cc(-c3cccc(-c4nc(-c5ccccc5)c5c(n4)oc4ccccc45)c3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C38H24N4O/c1-4-13-25(14-5-1)31-24-32(40-36(39-31)27-17-8-3-9-18-27)28-19-12-20-29(23-28)37-41-35(26-15-6-2-7-16-26)34-30-21-10-11-22-33(30)43-38(34)42-37/h1-24H |
| InChIKey | PJGDRTVPUYPQAX-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |