C22H23FN2O — CID 122628885
1-(1-adamantyl)-2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethanone (PubChem CID 122628885) has the molecular formula C22H23FN2O and a molecular weight of 350.44 g/mol. Its IUPAC name is 1-(1-adamantyl)-2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethanone.
| Compound Name | 1-(1-adamantyl)-2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethanone |
|---|---|
| PubChem CID | 122628885 |
| Molecular Formula | C22H23FN2O |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1-(1-adamantyl)-2-(6-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)ethanone |
| SMILES | O=C(CC1c2c(F)cccc2-c2cncn21)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H23FN2O/c23-17-3-1-2-16-19-11-24-12-25(19)18(21(16)17)7-20(26)22-8-13-4-14(9-22)6-15(5-13)10-22/h1-3,11-15,18H,4-10H2 |
| InChIKey | BQEDTZNVILXUMB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |