C25H27ClF3N5O4S — CID 122629193
N-[3-[3-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]propyl]-2,2,2-trifluoroacetamide (PubChem CID 122629193) has the molecular formula C25H27ClF3N5O4S and a molecular weight of 586.04 g/mol. Its IUPAC name is N-[3-[3-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]propyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[3-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]propyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 122629193 |
| Molecular Formula | C25H27ClF3N5O4S |
| Molecular Weight | 586.04 g/mol |
| Exact Mass | 585.14 |
| IUPAC Name | N-[3-[3-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]propyl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ccc(CCCNC(=O)C(F)(F)F)cc1Nc1ncc(Cl)c(Nc2ccccc2S(=O)(=O)C(C)C)n1 |
| InChI | InChI=1S/C25H27ClF3N5O4S/c1-15(2)39(36,37)21-9-5-4-8-18(21)32-22-17(26)14-31-24(34-22)33-19-13-16(10-11-20(19)38-3)7-6-12-30-23(35)25(27,28)29/h4-5,8-11,13-15H,6-7,12H2,1-3H3,(H,30,35)(H2,31,32,33,34) |
| InChIKey | ATIHNCGTGIFPNR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.04 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|