C22H22N6O2 — CID 122629343
4-[3-[(3R)-3-aminopiperidine-1-carbonyl]-5-(pyridin-2-ylmethoxy)pyrazol-1-yl]benzonitrile (PubChem CID 122629343) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 4-[3-[(3R)-3-aminopiperidine-1-carbonyl]-5-(pyridin-2-ylmethoxy)pyrazol-1-yl]benzonitrile.
| Compound Name | 4-[3-[(3R)-3-aminopiperidine-1-carbonyl]-5-(pyridin-2-ylmethoxy)pyrazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 122629343 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 4-[3-[(3R)-3-aminopiperidine-1-carbonyl]-5-(pyridin-2-ylmethoxy)pyrazol-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(-n2nc(C(=O)N3CCC[C@@H](N)C3)cc2OCc2ccccn2)cc1 |
| InChI | InChI=1S/C22H22N6O2/c23-13-16-6-8-19(9-7-16)28-21(30-15-18-5-1-2-10-25-18)12-20(26-28)22(29)27-11-3-4-17(24)14-27/h1-2,5-10,12,17H,3-4,11,14-15,24H2/t17-/m1/s1 |
| InChIKey | CFBCSWPEJOEMIS-QGZVFWFLSA-N |
| XLogP | 2.28 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |