C12H11BrN2 — CID 122629758
2-bromo-9-methyl-6,7-dihydropyrido[1,2-a]benzimidazole (PubChem CID 122629758) has the molecular formula C12H11BrN2 and a molecular weight of 263.14 g/mol. Its IUPAC name is 2-bromo-9-methyl-6,7-dihydropyrido[1,2-a]benzimidazole.
| Compound Name | 2-bromo-9-methyl-6,7-dihydropyrido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 122629758 |
| Molecular Formula | C12H11BrN2 |
| Molecular Weight | 263.14 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 2-bromo-9-methyl-6,7-dihydropyrido[1,2-a]benzimidazole |
| SMILES | CC1=CCCc2nc3ccc(Br)cn3c21 |
| InChI | InChI=1S/C12H11BrN2/c1-8-3-2-4-10-12(8)15-7-9(13)5-6-11(15)14-10/h3,5-7H,2,4H2,1H3 |
| InChIKey | MVIRUMZXTHDTOT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.14 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |