C32H41N6O4P — CID 122629845
ditert-butyl [1-[5-[(3R)-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]pyrimidin-2-yl]piperidin-4-yl] phosphate (PubChem CID 122629845) has the molecular formula C32H41N6O4P and a molecular weight of 604.69 g/mol. Its IUPAC name is ditert-butyl [1-[5-[(3R)-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]pyrimidin-2-yl]piperidin-4-yl] phosphate.
| Compound Name | ditert-butyl [1-[5-[(3R)-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]pyrimidin-2-yl]piperidin-4-yl] phosphate |
|---|---|
| PubChem CID | 122629845 |
| Molecular Formula | C32H41N6O4P |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | ditert-butyl [1-[5-[(3R)-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]pyrimidin-2-yl]piperidin-4-yl] phosphate |
| SMILES | CC(C)(C)OP(=O)(OC1CCN(c2ncc(-c3ccc4nc5n(c4n3)[C@@H](c3ccccc3)CC5)cn2)CC1)OC(C)(C)C |
| InChI | InChI=1S/C32H41N6O4P/c1-31(2,3)41-43(39,42-32(4,5)6)40-24-16-18-37(19-17-24)30-33-20-23(21-34-30)25-12-13-26-29(36-25)38-27(14-15-28(38)35-26)22-10-8-7-9-11-22/h7-13,20-21,24,27H,14-19H2,1-6H3/t27-/m1/s1 |
| InChIKey | YRWXARVUQXITOJ-HHHXNRCGSA-N |
| XLogP | 7.15 |
| TPSA | 104.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|