C18H27NO3 — CID 122629868
8,11,11b-trideuterio-3-(1,1,2,3,3,3-hexadeuterio-2-methylpropyl)-10-methoxy-1,2,3,4,6,7-hexahydrobenzo[a]quinolizine-2,9-diol (PubChem CID 122629868) has the molecular formula C18H27NO3 and a molecular weight of 314.47 g/mol. Its IUPAC name is 8,11,11b-trideuterio-3-(1,1,2,3,3,3-hexadeuterio-2-methylpropyl)-10-methoxy-1,2,3,4,6,7-hexahydrobenzo[a]quinolizine-2,9-diol.
| Compound Name | 8,11,11b-trideuterio-3-(1,1,2,3,3,3-hexadeuterio-2-methylpropyl)-10-methoxy-1,2,3,4,6,7-hexahydrobenzo[a]quinolizine-2,9-diol |
|---|---|
| PubChem CID | 122629868 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 8,11,11b-trideuterio-3-(1,1,2,3,3,3-hexadeuterio-2-methylpropyl)-10-methoxy-1,2,3,4,6,7-hexahydrobenzo[a]quinolizine-2,9-diol |
| SMILES | [2H]c1c(O)c(OC)c([2H])c2c1CCN1CC(C([2H])([2H])C([2H])(C)C([2H])([2H])[2H])C(O)CC21[2H] |
| InChI | InChI=1S/C18H27NO3/c1-11(2)6-13-10-19-5-4-12-7-17(21)18(22-3)8-14(12)15(19)9-16(13)20/h7-8,11,13,15-16,20-21H,4-6,9-10H2,1-3H3/i1D3,6D2,7D,8D,11D,15D |
| InChIKey | NNGHNWCGIHBKHE-RVVADPNLSA-N |
| XLogP | 2.73 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |