About (Z)-12-hydroxy-N,13-dimethyloctadec-9-enamide
(Z)-12-hydroxy-N,13-dimethyloctadec-9-enamide (PubChem CID 122629927) has the molecular formula C20H39NO2
and a molecular weight of 325.54 g/mol. Its IUPAC name is (Z)-12-hydroxy-N,13-dimethyloctadec-9-enamide.
Molecular Properties
| Compound Name | (Z)-12-hydroxy-N,13-dimethyloctadec-9-enamide |
| PubChem CID | 122629927 |
| Molecular Formula | C20H39NO2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.30 |
| IUPAC Name | (Z)-12-hydroxy-N,13-dimethyloctadec-9-enamide |
| SMILES | CCCCCC(C)C(O)C/C=C\CCCCCCCC(=O)NC |
| InChI | InChI=1S/C20H39NO2/c1-4-5-12-15-18(2)19(22)16-13-10-8-6-7-9-11-14-17-20(23)21-3/h10,13,18-19,22H,4-9,11-12,14-17H2,1-3H3,(H,21,23)/b13-10- |
| InChIKey | GJUUGVJEGOPFBN-RAXLEYEMSA-N |
| XLogP | 4.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-12-hydroxy-N,13-dimethyloctadec-9-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-12-hydroxy-N,13-dimethyloctadec-9-enamide?
The IUPAC name of (Z)-12-hydroxy-N,13-dimethyloctadec-9-enamide (CID 122629927) is (Z)-12-hydroxy-N,13-dimethyloctadec-9-enamide.
What is the SMILES notation for (Z)-12-hydroxy-N,13-dimethyloctadec-9-enamide?
The canonical SMILES for (Z)-12-hydroxy-N,13-dimethyloctadec-9-enamide is CCCCCC(C)C(O)C/C=C\CCCCCCCC(=O)NC.
What is the InChIKey of (Z)-12-hydroxy-N,13-dimethyloctadec-9-enamide?
The InChIKey is GJUUGVJEGOPFBN-RAXLEYEMSA-N. The full InChI is InChI=1S/C20H39NO2/c1-4-5-12-15-18(2)19(22)16-13-10-8-6-7-9-11-14-17-20(23)21-3/h10,13,18-19,22H,4-9,11-12,14-17H2,1-3H3,(H,21,23)/b13-10-.
What are the key properties of (Z)-12-hydroxy-N,13-dimethyloctadec-9-enamide?
(Z)-12-hydroxy-N,13-dimethyloctadec-9-enamide has a molecular weight of 325.54 g/mol, XLogP of 4.99, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-12-hydroxy-N,13-dimethyloctadec-9-enamide is sourced from PubChem (CID 122629927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).