About N-acetylacetamide
N-acetylacetamide (PubChem CID 12263) has the molecular formula C4H7NO2
and a molecular weight of 101.10 g/mol. Its IUPAC name is N-acetylacetamide.
Molecular Properties
| Compound Name | N-acetylacetamide |
| PubChem CID | 12263 |
| Molecular Formula | C4H7NO2 |
| Molecular Weight | 101.10 g/mol |
| Exact Mass | 101.05 |
| IUPAC Name | N-acetylacetamide |
| SMILES | CC(=O)NC(C)=O |
| InChI | InChI=1S/C4H7NO2/c1-3(6)5-4(2)7/h1-2H3,(H,5,6,7) |
| InChIKey | ZSBDPRIWBYHIAF-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.10 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-acetylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetylacetamide?
The IUPAC name of N-acetylacetamide (CID 12263) is N-acetylacetamide.
What is the SMILES notation for N-acetylacetamide?
The canonical SMILES for N-acetylacetamide is CC(=O)NC(C)=O.
What is the InChIKey of N-acetylacetamide?
The InChIKey is ZSBDPRIWBYHIAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2/c1-3(6)5-4(2)7/h1-2H3,(H,5,6,7).
What are the key properties of N-acetylacetamide?
N-acetylacetamide has a molecular weight of 101.10 g/mol, XLogP of -0.33, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetylacetamide is sourced from PubChem (CID 12263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).