About 2-(3,4,5,6-tetrahydroxyoxan-2-yl)propanal
2-(3,4,5,6-tetrahydroxyoxan-2-yl)propanal (PubChem CID 122630065) has the molecular formula C8H14O6
and a molecular weight of 206.19 g/mol. Its IUPAC name is 2-(3,4,5,6-tetrahydroxyoxan-2-yl)propanal.
Molecular Properties
| Compound Name | 2-(3,4,5,6-tetrahydroxyoxan-2-yl)propanal |
| PubChem CID | 122630065 |
| Molecular Formula | C8H14O6 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2-(3,4,5,6-tetrahydroxyoxan-2-yl)propanal |
| SMILES | CC(C=O)C1OC(O)C(O)C(O)C1O |
| InChI | InChI=1S/C8H14O6/c1-3(2-9)7-5(11)4(10)6(12)8(13)14-7/h2-8,10-13H,1H3 |
| InChIKey | JEQIFSQBHOGUMO-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4,5,6-tetrahydroxyoxan-2-yl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4,5,6-tetrahydroxyoxan-2-yl)propanal?
The IUPAC name of 2-(3,4,5,6-tetrahydroxyoxan-2-yl)propanal (CID 122630065) is 2-(3,4,5,6-tetrahydroxyoxan-2-yl)propanal.
What is the SMILES notation for 2-(3,4,5,6-tetrahydroxyoxan-2-yl)propanal?
The canonical SMILES for 2-(3,4,5,6-tetrahydroxyoxan-2-yl)propanal is CC(C=O)C1OC(O)C(O)C(O)C1O.
What is the InChIKey of 2-(3,4,5,6-tetrahydroxyoxan-2-yl)propanal?
The InChIKey is JEQIFSQBHOGUMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O6/c1-3(2-9)7-5(11)4(10)6(12)8(13)14-7/h2-8,10-13H,1H3.
What are the key properties of 2-(3,4,5,6-tetrahydroxyoxan-2-yl)propanal?
2-(3,4,5,6-tetrahydroxyoxan-2-yl)propanal has a molecular weight of 206.19 g/mol, XLogP of -2.38, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4,5,6-tetrahydroxyoxan-2-yl)propanal is sourced from PubChem (CID 122630065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).