C23H17F7O — CID 122630239
1-[[2,6-difluoro-4-(4-propylphenyl)phenyl]-difluoromethoxy]-3,4,5-trifluoro-2-methylbenzene (PubChem CID 122630239) has the molecular formula C23H17F7O and a molecular weight of 442.37 g/mol. Its IUPAC name is 1-[[2,6-difluoro-4-(4-propylphenyl)phenyl]-difluoromethoxy]-3,4,5-trifluoro-2-methylbenzene.
| Compound Name | 1-[[2,6-difluoro-4-(4-propylphenyl)phenyl]-difluoromethoxy]-3,4,5-trifluoro-2-methylbenzene |
|---|---|
| PubChem CID | 122630239 |
| Molecular Formula | C23H17F7O |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 1-[[2,6-difluoro-4-(4-propylphenyl)phenyl]-difluoromethoxy]-3,4,5-trifluoro-2-methylbenzene |
| SMILES | CCCc1ccc(-c2cc(F)c(C(F)(F)Oc3cc(F)c(F)c(F)c3C)c(F)c2)cc1 |
| InChI | InChI=1S/C23H17F7O/c1-3-4-13-5-7-14(8-6-13)15-9-16(24)20(17(25)10-15)23(29,30)31-19-11-18(26)22(28)21(27)12(19)2/h5-11H,3-4H2,1-2H3 |
| InChIKey | QXDAODVIURYQBR-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|