C30H37FN6O10 — CID 122631252
(2S)-2-[3-[1-carboxy-5-[4-[4-[4-(3-fluoropropyl)triazol-1-yl]phenyl]butanoylamino]pentyl]-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid (PubChem CID 122631252) has the molecular formula C30H37FN6O10 and a molecular weight of 660.66 g/mol. Its IUPAC name is (2S)-2-[3-[1-carboxy-5-[4-[4-[4-(3-fluoropropyl)triazol-1-yl]phenyl]butanoylamino]pentyl]-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid.
| Compound Name | (2S)-2-[3-[1-carboxy-5-[4-[4-[4-(3-fluoropropyl)triazol-1-yl]phenyl]butanoylamino]pentyl]-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid |
|---|---|
| PubChem CID | 122631252 |
| Molecular Formula | C30H37FN6O10 |
| Molecular Weight | 660.66 g/mol |
| Exact Mass | 660.26 |
| IUPAC Name | (2S)-2-[3-[1-carboxy-5-[4-[4-[4-(3-fluoropropyl)triazol-1-yl]phenyl]butanoylamino]pentyl]-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid |
| SMILES | O=C(O)CC[C@@H](C(=O)O)N1C(=O)CC(=O)N(C(CCCCNC(=O)CCCc2ccc(-n3cc(CCCF)nn3)cc2)C(=O)O)C1=O |
| InChI | InChI=1S/C30H37FN6O10/c31-15-4-6-20-18-35(34-33-20)21-11-9-19(10-12-21)5-3-8-24(38)32-16-2-1-7-22(28(43)44)36-25(39)17-26(40)37(30(36)47)23(29(45)46)13-14-27(41)42/h9-12,18,22-23H,1-8,13-17H2,(H,32,38)(H,41,42)(H,43,44)(H,45,46)/t22?,23-/m0/s1 |
| InChIKey | IYVYQORKQJUKBJ-WCSIJFPASA-N |
| XLogP | 1.73 |
| TPSA | 229.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.66 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|