C23H31FN4O9 — CID 122631279
(2S)-2-[[[1-carboxy-5-[[4-(2-fluoropropanoylamino)benzoyl]amino]pentyl]-methylcarbamoyl]amino]pentanedioic acid (PubChem CID 122631279) has the molecular formula C23H31FN4O9 and a molecular weight of 526.52 g/mol. Its IUPAC name is (2S)-2-[[[1-carboxy-5-[[4-(2-fluoropropanoylamino)benzoyl]amino]pentyl]-methylcarbamoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[[1-carboxy-5-[[4-(2-fluoropropanoylamino)benzoyl]amino]pentyl]-methylcarbamoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 122631279 |
| Molecular Formula | C23H31FN4O9 |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | (2S)-2-[[[1-carboxy-5-[[4-(2-fluoropropanoylamino)benzoyl]amino]pentyl]-methylcarbamoyl]amino]pentanedioic acid |
| SMILES | CC(F)C(=O)Nc1ccc(C(=O)NCCCCC(C(=O)O)N(C)C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C23H31FN4O9/c1-13(24)19(31)26-15-8-6-14(7-9-15)20(32)25-12-4-3-5-17(22(35)36)28(2)23(37)27-16(21(33)34)10-11-18(29)30/h6-9,13,16-17H,3-5,10-12H2,1-2H3,(H,25,32)(H,26,31)(H,27,37)(H,29,30)(H,33,34)(H,35,36)/t13?,16-,17?/m0/s1 |
| InChIKey | XLQUXJPVBLVHHL-PWZRNIHTSA-N |
| XLogP | 1.30 |
| TPSA | 202.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|