C11H14O3 — CID 122631824
(2R,3R,7S,7aS)-2-ethenyl-7-methyl-5-methylidene-2,3,7,7a-tetrahydrofuro[3,4-b]pyran-3-ol (PubChem CID 122631824) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (2R,3R,7S,7aS)-2-ethenyl-7-methyl-5-methylidene-2,3,7,7a-tetrahydrofuro[3,4-b]pyran-3-ol.
| Compound Name | (2R,3R,7S,7aS)-2-ethenyl-7-methyl-5-methylidene-2,3,7,7a-tetrahydrofuro[3,4-b]pyran-3-ol |
|---|---|
| PubChem CID | 122631824 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (2R,3R,7S,7aS)-2-ethenyl-7-methyl-5-methylidene-2,3,7,7a-tetrahydrofuro[3,4-b]pyran-3-ol |
| SMILES | C=C[C@H]1O[C@H]2C(=C[C@H]1O)C(=C)O[C@H]2C |
| InChI | InChI=1S/C11H14O3/c1-4-10-9(12)5-8-6(2)13-7(3)11(8)14-10/h4-5,7,9-12H,1-2H2,3H3/t7-,9+,10+,11+/m0/s1 |
| InChIKey | CLELXYJFWJFTBB-AYHFEMFVSA-N |
| XLogP | 1.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|