C16H12F6 — CID 122631883
1,2,4-trifluoro-3,5-dimethyl-6-(2,3,6-trifluoro-4,5-dimethylphenyl)benzene (PubChem CID 122631883) has the molecular formula C16H12F6 and a molecular weight of 318.26 g/mol. Its IUPAC name is 1,2,4-trifluoro-3,5-dimethyl-6-(2,3,6-trifluoro-4,5-dimethylphenyl)benzene.
| Compound Name | 1,2,4-trifluoro-3,5-dimethyl-6-(2,3,6-trifluoro-4,5-dimethylphenyl)benzene |
|---|---|
| PubChem CID | 122631883 |
| Molecular Formula | C16H12F6 |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 1,2,4-trifluoro-3,5-dimethyl-6-(2,3,6-trifluoro-4,5-dimethylphenyl)benzene |
| SMILES | Cc1c(F)c(C)c(-c2c(F)c(C)c(C)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C16H12F6/c1-5-6(2)13(19)16(22)10(12(5)18)9-7(3)11(17)8(4)14(20)15(9)21/h1-4H3 |
| InChIKey | AUCDNLDDAJFVHW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|