C17H22N2O3 — CID 122632324
N-hydroxy-2'-oxo-1'-propan-2-ylspiro[6,8-dihydro-5H-naphthalene-7,4'-pyrrolidine]-2-carboxamide (PubChem CID 122632324) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is N-hydroxy-2'-oxo-1'-propan-2-ylspiro[6,8-dihydro-5H-naphthalene-7,4'-pyrrolidine]-2-carboxamide.
| Compound Name | N-hydroxy-2'-oxo-1'-propan-2-ylspiro[6,8-dihydro-5H-naphthalene-7,4'-pyrrolidine]-2-carboxamide |
|---|---|
| PubChem CID | 122632324 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-hydroxy-2'-oxo-1'-propan-2-ylspiro[6,8-dihydro-5H-naphthalene-7,4'-pyrrolidine]-2-carboxamide |
| SMILES | CC(C)N1CC2(CCc3ccc(C(=O)NO)cc3C2)CC1=O |
| InChI | InChI=1S/C17H22N2O3/c1-11(2)19-10-17(9-15(19)20)6-5-12-3-4-13(16(21)18-22)7-14(12)8-17/h3-4,7,11,22H,5-6,8-10H2,1-2H3,(H,18,21) |
| InChIKey | ICOORWMVUXPNCY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|