About 2-(oxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine
2-(oxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 122632726) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-(oxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine.
Molecular Properties
| Compound Name | 2-(oxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine |
| PubChem CID | 122632726 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 2-(oxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | NC1=NC(C2CCOCC2)CC1 |
| InChI | InChI=1S/C9H16N2O/c10-9-2-1-8(11-9)7-3-5-12-6-4-7/h7-8H,1-6H2,(H2,10,11) |
| InChIKey | QQTPUAWAEWTBBZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(oxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine?
The IUPAC name of 2-(oxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine (CID 122632726) is 2-(oxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine.
What is the SMILES notation for 2-(oxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine?
The canonical SMILES for 2-(oxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine is NC1=NC(C2CCOCC2)CC1.
What is the InChIKey of 2-(oxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine?
The InChIKey is QQTPUAWAEWTBBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c10-9-2-1-8(11-9)7-3-5-12-6-4-7/h7-8H,1-6H2,(H2,10,11).
What are the key properties of 2-(oxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine?
2-(oxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine has a molecular weight of 168.24 g/mol, XLogP of 0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-4-yl)-3,4-dihydro-2H-pyrrol-5-amine is sourced from PubChem (CID 122632726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).