C24H25FN4O2 — CID 122633736
5-[3-[(3-fluorophenyl)methyl]-7-[[(1S)-1-hydroxypropyl]amino]benzimidazol-5-yl]-1,3-dimethylpyridin-2-one (PubChem CID 122633736) has the molecular formula C24H25FN4O2 and a molecular weight of 420.49 g/mol. Its IUPAC name is 5-[3-[(3-fluorophenyl)methyl]-7-[[(1S)-1-hydroxypropyl]amino]benzimidazol-5-yl]-1,3-dimethylpyridin-2-one.
| Compound Name | 5-[3-[(3-fluorophenyl)methyl]-7-[[(1S)-1-hydroxypropyl]amino]benzimidazol-5-yl]-1,3-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 122633736 |
| Molecular Formula | C24H25FN4O2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 5-[3-[(3-fluorophenyl)methyl]-7-[[(1S)-1-hydroxypropyl]amino]benzimidazol-5-yl]-1,3-dimethylpyridin-2-one |
| SMILES | CC[C@H](O)Nc1cc(-c2cc(C)c(=O)n(C)c2)cc2c1ncn2Cc1cccc(F)c1 |
| InChI | InChI=1S/C24H25FN4O2/c1-4-22(30)27-20-10-17(18-8-15(2)24(31)28(3)13-18)11-21-23(20)26-14-29(21)12-16-6-5-7-19(25)9-16/h5-11,13-14,22,27,30H,4,12H2,1-3H3/t22-/m0/s1 |
| InChIKey | MXUHZGAQSADXCY-QFIPXVFZSA-N |
| XLogP | 4.04 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|