C47H31F3N2O4S — CID 122634297
[5-(N-dibenzofuran-2-yl-4-naphthalen-1-ylanilino)-2-(N-phenylanilino)phenyl] trifluoromethanesulfonate (PubChem CID 122634297) has the molecular formula C47H31F3N2O4S and a molecular weight of 776.84 g/mol. Its IUPAC name is [5-(N-dibenzofuran-2-yl-4-naphthalen-1-ylanilino)-2-(N-phenylanilino)phenyl] trifluoromethanesulfonate.
| Compound Name | [5-(N-dibenzofuran-2-yl-4-naphthalen-1-ylanilino)-2-(N-phenylanilino)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122634297 |
| Molecular Formula | C47H31F3N2O4S |
| Molecular Weight | 776.84 g/mol |
| Exact Mass | 776.20 |
| IUPAC Name | [5-(N-dibenzofuran-2-yl-4-naphthalen-1-ylanilino)-2-(N-phenylanilino)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(N(c2ccc(-c3cccc4ccccc34)cc2)c2ccc3oc4ccccc4c3c2)ccc1N(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C47H31F3N2O4S/c48-47(49,50)57(53,54)56-46-31-38(26-28-43(46)52(34-14-3-1-4-15-34)35-16-5-2-6-17-35)51(37-27-29-45-42(30-37)41-19-9-10-21-44(41)55-45)36-24-22-33(23-25-36)40-20-11-13-32-12-7-8-18-39(32)40/h1-31H |
| InChIKey | JRHAVTAHEMFKNZ-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.84 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|