C22H17F3N4O2 — CID 122634627
3-[(2-ethoxy-3,5,6-trifluoro-4-pyridinyl)amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 122634627) has the molecular formula C22H17F3N4O2 and a molecular weight of 426.40 g/mol. Its IUPAC name is 3-[(2-ethoxy-3,5,6-trifluoro-4-pyridinyl)amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 3-[(2-ethoxy-3,5,6-trifluoro-4-pyridinyl)amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 122634627 |
| Molecular Formula | C22H17F3N4O2 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 3-[(2-ethoxy-3,5,6-trifluoro-4-pyridinyl)amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | CCOc1nc(F)c(F)c(NC2N=C(c3ccccc3)c3ccccc3NC2=O)c1F |
| InChI | InChI=1S/C22H17F3N4O2/c1-2-31-22-16(24)18(15(23)19(25)29-22)28-20-21(30)26-14-11-7-6-10-13(14)17(27-20)12-8-4-3-5-9-12/h3-11,20H,2H2,1H3,(H,26,30)(H,28,29) |
| InChIKey | AJVGQZHWLQJFPI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|