C29H48O3 — CID 122634730
(E)-7-hydroxy-3,7,11-trimethyl-14-(2,7,8-trimethyl-3,4,8,8a-tetrahydrochromen-2-yl)tetradec-11-en-2-one (PubChem CID 122634730) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is (E)-7-hydroxy-3,7,11-trimethyl-14-(2,7,8-trimethyl-3,4,8,8a-tetrahydrochromen-2-yl)tetradec-11-en-2-one.
| Compound Name | (E)-7-hydroxy-3,7,11-trimethyl-14-(2,7,8-trimethyl-3,4,8,8a-tetrahydrochromen-2-yl)tetradec-11-en-2-one |
|---|---|
| PubChem CID | 122634730 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | (E)-7-hydroxy-3,7,11-trimethyl-14-(2,7,8-trimethyl-3,4,8,8a-tetrahydrochromen-2-yl)tetradec-11-en-2-one |
| SMILES | CC(=O)C(C)CCCC(C)(O)CCC/C(C)=C/CCC1(C)CCC2=CC=C(C)C(C)C2O1 |
| InChI | InChI=1S/C29H48O3/c1-21(11-8-17-28(6,31)18-10-13-23(3)25(5)30)12-9-19-29(7)20-16-26-15-14-22(2)24(4)27(26)32-29/h12,14-15,23-24,27,31H,8-11,13,16-20H2,1-7H3/b21-12+ |
| InChIKey | HRDMKZYUTPXYSS-CIAFOILYSA-N |
| XLogP | 7.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|