C25H26N4O3S3 — CID 122635070
2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]-N-prop-2-enylacetamide (PubChem CID 122635070) has the molecular formula C25H26N4O3S3 and a molecular weight of 526.71 g/mol. Its IUPAC name is 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]-N-prop-2-enylacetamide.
| Compound Name | 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 122635070 |
| Molecular Formula | C25H26N4O3S3 |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)COc1ccc(-c2cc(-c3nccs3)nc3sc(S(=O)CCCC)c(N)c23)cc1 |
| InChI | InChI=1S/C25H26N4O3S3/c1-3-5-13-35(31)25-22(26)21-18(14-19(29-24(21)34-25)23-28-11-12-33-23)16-6-8-17(9-7-16)32-15-20(30)27-10-4-2/h4,6-9,11-12,14H,2-3,5,10,13,15,26H2,1H3,(H,27,30) |
| InChIKey | NDGHKQNSDCCWCG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|