About methyl 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]acetate
methyl 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]acetate (PubChem CID 122635078) has the molecular formula C23H23N3O3S3
and a molecular weight of 485.66 g/mol. Its IUPAC name is methyl 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]acetate |
| PubChem CID | 122635078 |
| Molecular Formula | C23H23N3O3S3 |
| Molecular Weight | 485.66 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | methyl 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]acetate |
| SMILES | CCCCS(=O)c1sc2nc(-c3nccs3)cc(-c3ccc(CC(=O)OC)cc3)c2c1N |
| InChI | InChI=1S/C23H23N3O3S3/c1-3-4-11-32(28)23-20(24)19-16(15-7-5-14(6-8-15)12-18(27)29-2)13-17(26-22(19)31-23)21-25-9-10-30-21/h5-10,13H,3-4,11-12,24H2,1-2H3 |
| InChIKey | VUJDGXCCZIJRLM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]acetate?
The IUPAC name of methyl 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]acetate (CID 122635078) is methyl 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]acetate.
What is the SMILES notation for methyl 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]acetate?
The canonical SMILES for methyl 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]acetate is CCCCS(=O)c1sc2nc(-c3nccs3)cc(-c3ccc(CC(=O)OC)cc3)c2c1N.
What is the InChIKey of methyl 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]acetate?
The InChIKey is VUJDGXCCZIJRLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3O3S3/c1-3-4-11-32(28)23-20(24)19-16(15-7-5-14(6-8-15)12-18(27)29-2)13-17(26-22(19)31-23)21-25-9-10-30-21/h5-10,13H,3-4,11-12,24H2,1-2H3.
What are the key properties of methyl 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]acetate?
methyl 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]acetate has a molecular weight of 485.66 g/mol, XLogP of 5.29, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenyl]acetate is sourced from PubChem (CID 122635078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).