C23H31N9O3S — CID 122635304
6-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-5-methoxy-N-(5-methyl-1H-pyrazol-3-yl)-2-(4-nitrophenyl)sulfanylpyrimidin-4-amine (PubChem CID 122635304) has the molecular formula C23H31N9O3S and a molecular weight of 513.63 g/mol. Its IUPAC name is 6-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-5-methoxy-N-(5-methyl-1H-pyrazol-3-yl)-2-(4-nitrophenyl)sulfanylpyrimidin-4-amine.
| Compound Name | 6-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-5-methoxy-N-(5-methyl-1H-pyrazol-3-yl)-2-(4-nitrophenyl)sulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 122635304 |
| Molecular Formula | C23H31N9O3S |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 6-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-5-methoxy-N-(5-methyl-1H-pyrazol-3-yl)-2-(4-nitrophenyl)sulfanylpyrimidin-4-amine |
| SMILES | COc1c(Nc2cc(C)[nH]n2)nc(Sc2ccc([N+](=O)[O-])cc2)nc1N1CCN(CCN(C)C)CC1 |
| InChI | InChI=1S/C23H31N9O3S/c1-16-15-19(28-27-16)24-21-20(35-4)22(31-13-11-30(12-14-31)10-9-29(2)3)26-23(25-21)36-18-7-5-17(6-8-18)32(33)34/h5-8,15H,9-14H2,1-4H3,(H2,24,25,26,27,28) |
| InChIKey | LPHHLDXCKBWWKM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|