About (6Z)-7a-ethynyl-6-(hydroxymethylidene)-3,3-dimethyl-2,7-dihydro-1H-inden-5-one
(6Z)-7a-ethynyl-6-(hydroxymethylidene)-3,3-dimethyl-2,7-dihydro-1H-inden-5-one (PubChem CID 122635526) has the molecular formula C14H16O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is (6Z)-7a-ethynyl-6-(hydroxymethylidene)-3,3-dimethyl-2,7-dihydro-1H-inden-5-one.
Molecular Properties
| Compound Name | (6Z)-7a-ethynyl-6-(hydroxymethylidene)-3,3-dimethyl-2,7-dihydro-1H-inden-5-one |
| PubChem CID | 122635526 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (6Z)-7a-ethynyl-6-(hydroxymethylidene)-3,3-dimethyl-2,7-dihydro-1H-inden-5-one |
| SMILES | C#CC12CCC(C)(C)C1=CC(=O)/C(=C\O)C2 |
| InChI | InChI=1S/C14H16O2/c1-4-14-6-5-13(2,3)12(14)7-11(16)10(8-14)9-15/h1,7,9,15H,5-6,8H2,2-3H3/b10-9- |
| InChIKey | TVKZSYXBROINDS-KTKRTIGZSA-N |
| XLogP | 2.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-7a-ethynyl-6-(hydroxymethylidene)-3,3-dimethyl-2,7-dihydro-1H-inden-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-7a-ethynyl-6-(hydroxymethylidene)-3,3-dimethyl-2,7-dihydro-1H-inden-5-one?
The IUPAC name of (6Z)-7a-ethynyl-6-(hydroxymethylidene)-3,3-dimethyl-2,7-dihydro-1H-inden-5-one (CID 122635526) is (6Z)-7a-ethynyl-6-(hydroxymethylidene)-3,3-dimethyl-2,7-dihydro-1H-inden-5-one.
What is the SMILES notation for (6Z)-7a-ethynyl-6-(hydroxymethylidene)-3,3-dimethyl-2,7-dihydro-1H-inden-5-one?
The canonical SMILES for (6Z)-7a-ethynyl-6-(hydroxymethylidene)-3,3-dimethyl-2,7-dihydro-1H-inden-5-one is C#CC12CCC(C)(C)C1=CC(=O)/C(=C\O)C2.
What is the InChIKey of (6Z)-7a-ethynyl-6-(hydroxymethylidene)-3,3-dimethyl-2,7-dihydro-1H-inden-5-one?
The InChIKey is TVKZSYXBROINDS-KTKRTIGZSA-N. The full InChI is InChI=1S/C14H16O2/c1-4-14-6-5-13(2,3)12(14)7-11(16)10(8-14)9-15/h1,7,9,15H,5-6,8H2,2-3H3/b10-9-.
What are the key properties of (6Z)-7a-ethynyl-6-(hydroxymethylidene)-3,3-dimethyl-2,7-dihydro-1H-inden-5-one?
(6Z)-7a-ethynyl-6-(hydroxymethylidene)-3,3-dimethyl-2,7-dihydro-1H-inden-5-one has a molecular weight of 216.28 g/mol, XLogP of 2.77, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-7a-ethynyl-6-(hydroxymethylidene)-3,3-dimethyl-2,7-dihydro-1H-inden-5-one is sourced from PubChem (CID 122635526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).