C16H23NO6S — CID 122636162
(2R,3S,4R)-2-benzyl-4-methoxy-3-methyl-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylic acid (PubChem CID 122636162) has the molecular formula C16H23NO6S and a molecular weight of 357.43 g/mol. Its IUPAC name is (2R,3S,4R)-2-benzyl-4-methoxy-3-methyl-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylic acid.
| Compound Name | (2R,3S,4R)-2-benzyl-4-methoxy-3-methyl-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 122636162 |
| Molecular Formula | C16H23NO6S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (2R,3S,4R)-2-benzyl-4-methoxy-3-methyl-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylic acid |
| SMILES | CO[C@H]1CN(C(=O)O)[C@](COS(C)(=O)=O)(Cc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C16H23NO6S/c1-12-14(22-2)10-17(15(18)19)16(12,11-23-24(3,20)21)9-13-7-5-4-6-8-13/h4-8,12,14H,9-11H2,1-3H3,(H,18,19)/t12-,14+,16+/m1/s1 |
| InChIKey | JAXLNFVTRGUDKB-INWMFGNUSA-N |
| XLogP | 1.59 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|