About 6-chloro-3-[[(5-fluoro-1,2,3-benzothiadiazol-6-yl)amino]methyl]-1H-quinolin-2-one
6-chloro-3-[[(5-fluoro-1,2,3-benzothiadiazol-6-yl)amino]methyl]-1H-quinolin-2-one (PubChem CID 122637177) has the molecular formula C16H10ClFN4OS
and a molecular weight of 360.80 g/mol. Its IUPAC name is 6-chloro-3-[[(5-fluoro-1,2,3-benzothiadiazol-6-yl)amino]methyl]-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 6-chloro-3-[[(5-fluoro-1,2,3-benzothiadiazol-6-yl)amino]methyl]-1H-quinolin-2-one |
| PubChem CID | 122637177 |
| Molecular Formula | C16H10ClFN4OS |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 6-chloro-3-[[(5-fluoro-1,2,3-benzothiadiazol-6-yl)amino]methyl]-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccc(Cl)cc2cc1CNc1cc2snnc2cc1F |
| InChI | InChI=1S/C16H10ClFN4OS/c17-10-1-2-12-8(4-10)3-9(16(23)20-12)7-19-13-6-15-14(5-11(13)18)21-22-24-15/h1-6,19H,7H2,(H,20,23) |
| InChIKey | FWCAXFUCNUPHGX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-3-[[(5-fluoro-1,2,3-benzothiadiazol-6-yl)amino]methyl]-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-[[(5-fluoro-1,2,3-benzothiadiazol-6-yl)amino]methyl]-1H-quinolin-2-one?
The IUPAC name of 6-chloro-3-[[(5-fluoro-1,2,3-benzothiadiazol-6-yl)amino]methyl]-1H-quinolin-2-one (CID 122637177) is 6-chloro-3-[[(5-fluoro-1,2,3-benzothiadiazol-6-yl)amino]methyl]-1H-quinolin-2-one.
What is the SMILES notation for 6-chloro-3-[[(5-fluoro-1,2,3-benzothiadiazol-6-yl)amino]methyl]-1H-quinolin-2-one?
The canonical SMILES for 6-chloro-3-[[(5-fluoro-1,2,3-benzothiadiazol-6-yl)amino]methyl]-1H-quinolin-2-one is O=c1[nH]c2ccc(Cl)cc2cc1CNc1cc2snnc2cc1F.
What is the InChIKey of 6-chloro-3-[[(5-fluoro-1,2,3-benzothiadiazol-6-yl)amino]methyl]-1H-quinolin-2-one?
The InChIKey is FWCAXFUCNUPHGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClFN4OS/c17-10-1-2-12-8(4-10)3-9(16(23)20-12)7-19-13-6-15-14(5-11(13)18)21-22-24-15/h1-6,19H,7H2,(H,20,23).
What are the key properties of 6-chloro-3-[[(5-fluoro-1,2,3-benzothiadiazol-6-yl)amino]methyl]-1H-quinolin-2-one?
6-chloro-3-[[(5-fluoro-1,2,3-benzothiadiazol-6-yl)amino]methyl]-1H-quinolin-2-one has a molecular weight of 360.80 g/mol, XLogP of 3.94, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-[[(5-fluoro-1,2,3-benzothiadiazol-6-yl)amino]methyl]-1H-quinolin-2-one is sourced from PubChem (CID 122637177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).