C10H16N2O5S2 — CID 122638343
[2,2-dimethyl-5-(4-methyl-1,3-thiazol-5-yl)-1,3-dioxolan-4-yl]-methylsulfamic acid (PubChem CID 122638343) has the molecular formula C10H16N2O5S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is [2,2-dimethyl-5-(4-methyl-1,3-thiazol-5-yl)-1,3-dioxolan-4-yl]-methylsulfamic acid.
| Compound Name | [2,2-dimethyl-5-(4-methyl-1,3-thiazol-5-yl)-1,3-dioxolan-4-yl]-methylsulfamic acid |
|---|---|
| PubChem CID | 122638343 |
| Molecular Formula | C10H16N2O5S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | [2,2-dimethyl-5-(4-methyl-1,3-thiazol-5-yl)-1,3-dioxolan-4-yl]-methylsulfamic acid |
| SMILES | Cc1ncsc1C1OC(C)(C)OC1N(C)S(=O)(=O)O |
| InChI | InChI=1S/C10H16N2O5S2/c1-6-8(18-5-11-6)7-9(12(4)19(13,14)15)17-10(2,3)16-7/h5,7,9H,1-4H3,(H,13,14,15) |
| InChIKey | VZRBINOBHASPDO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|