C23H20F4N6O5 — CID 122638644
N-[3-(6-fluoro-2-pyridinyl)-1-[3-(2,2,2-trifluoroethoxy)cyclobutyl]pyrazol-4-yl]-5-(1H-pyrazol-4-yl)furan-2-carboxamide;formic acid (PubChem CID 122638644) has the molecular formula C23H20F4N6O5 and a molecular weight of 536.44 g/mol. Its IUPAC name is N-[3-(6-fluoro-2-pyridinyl)-1-[3-(2,2,2-trifluoroethoxy)cyclobutyl]pyrazol-4-yl]-5-(1H-pyrazol-4-yl)furan-2-carboxamide;formic acid.
| Compound Name | N-[3-(6-fluoro-2-pyridinyl)-1-[3-(2,2,2-trifluoroethoxy)cyclobutyl]pyrazol-4-yl]-5-(1H-pyrazol-4-yl)furan-2-carboxamide;formic acid |
|---|---|
| PubChem CID | 122638644 |
| Molecular Formula | C23H20F4N6O5 |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | N-[3-(6-fluoro-2-pyridinyl)-1-[3-(2,2,2-trifluoroethoxy)cyclobutyl]pyrazol-4-yl]-5-(1H-pyrazol-4-yl)furan-2-carboxamide;formic acid |
| SMILES | O=C(Nc1cn(C2CC(OCC(F)(F)F)C2)nc1-c1cccc(F)n1)c1ccc(-c2cn[nH]c2)o1.O=CO |
| InChI | InChI=1S/C22H18F4N6O3.CH2O2/c23-19-3-1-2-15(29-19)20-16(10-32(31-20)13-6-14(7-13)34-11-22(24,25)26)30-21(33)18-5-4-17(35-18)12-8-27-28-9-12;2-1-3/h1-5,8-10,13-14H,6-7,11H2,(H,27,28)(H,30,33);1H,(H,2,3) |
| InChIKey | JIZLYKWMWHDJJM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 148.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|