C20H17F3N6O3 — CID 122638656
5-(1H-pyrazol-5-yl)-N-[3-pyridin-2-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-4-yl]furan-2-carboxamide (PubChem CID 122638656) has the molecular formula C20H17F3N6O3 and a molecular weight of 446.39 g/mol. Its IUPAC name is 5-(1H-pyrazol-5-yl)-N-[3-pyridin-2-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-4-yl]furan-2-carboxamide.
| Compound Name | 5-(1H-pyrazol-5-yl)-N-[3-pyridin-2-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 122638656 |
| Molecular Formula | C20H17F3N6O3 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 5-(1H-pyrazol-5-yl)-N-[3-pyridin-2-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazol-4-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1cn(CCOCC(F)(F)F)nc1-c1ccccn1)c1ccc(-c2ccn[nH]2)o1 |
| InChI | InChI=1S/C20H17F3N6O3/c21-20(22,23)12-31-10-9-29-11-15(18(28-29)14-3-1-2-7-24-14)26-19(30)17-5-4-16(32-17)13-6-8-25-27-13/h1-8,11H,9-10,12H2,(H,25,27)(H,26,30) |
| InChIKey | IOLXVNMMZXMEFZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|