C28H21F6N7O4S — CID 122638746
[1,1,1,3,3,3-hexafluoro-2-[[4-[[2-[1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]-1,3-thiazole-4-carbonyl]amino]-3-pyridin-2-ylpyrazol-1-yl]methyl]propan-2-yl] formate (PubChem CID 122638746) has the molecular formula C28H21F6N7O4S and a molecular weight of 665.58 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[[4-[[2-[1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]-1,3-thiazole-4-carbonyl]amino]-3-pyridin-2-ylpyrazol-1-yl]methyl]propan-2-yl] formate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[[4-[[2-[1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]-1,3-thiazole-4-carbonyl]amino]-3-pyridin-2-ylpyrazol-1-yl]methyl]propan-2-yl] formate |
|---|---|
| PubChem CID | 122638746 |
| Molecular Formula | C28H21F6N7O4S |
| Molecular Weight | 665.58 g/mol |
| Exact Mass | 665.13 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[[4-[[2-[1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]-1,3-thiazole-4-carbonyl]amino]-3-pyridin-2-ylpyrazol-1-yl]methyl]propan-2-yl] formate |
| SMILES | COc1ccc(Cn2cc(-c3nc(C(=O)Nc4cn(CC(OC=O)(C(F)(F)F)C(F)(F)F)nc4-c4ccccn4)cs3)cn2)cc1 |
| InChI | InChI=1S/C28H21F6N7O4S/c1-44-19-7-5-17(6-8-19)11-40-12-18(10-36-40)25-38-22(14-46-25)24(43)37-21-13-41(39-23(21)20-4-2-3-9-35-20)15-26(45-16-42,27(29,30)31)28(32,33)34/h2-10,12-14,16H,11,15H2,1H3,(H,37,43) |
| InChIKey | GNXWDMVQEYHXRR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.58 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|