C23H25N7O4S — CID 122638764
N-[1-[(1S,3R)-3-ethoxycyclopentyl]-3-pyridin-2-ylpyrazol-4-yl]-2-(1H-pyrazol-4-yl)-1,3-thiazole-4-carboxamide;formic acid (PubChem CID 122638764) has the molecular formula C23H25N7O4S and a molecular weight of 495.57 g/mol. Its IUPAC name is N-[1-[(1S,3R)-3-ethoxycyclopentyl]-3-pyridin-2-ylpyrazol-4-yl]-2-(1H-pyrazol-4-yl)-1,3-thiazole-4-carboxamide;formic acid.
| Compound Name | N-[1-[(1S,3R)-3-ethoxycyclopentyl]-3-pyridin-2-ylpyrazol-4-yl]-2-(1H-pyrazol-4-yl)-1,3-thiazole-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 122638764 |
| Molecular Formula | C23H25N7O4S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | N-[1-[(1S,3R)-3-ethoxycyclopentyl]-3-pyridin-2-ylpyrazol-4-yl]-2-(1H-pyrazol-4-yl)-1,3-thiazole-4-carboxamide;formic acid |
| SMILES | CCO[C@@H]1CC[C@H](n2cc(NC(=O)c3csc(-c4cn[nH]c4)n3)c(-c3ccccn3)n2)C1.O=CO |
| InChI | InChI=1S/C22H23N7O2S.CH2O2/c1-2-31-16-7-6-15(9-16)29-12-18(20(28-29)17-5-3-4-8-23-17)26-21(30)19-13-32-22(27-19)14-10-24-25-11-14;2-1-3/h3-5,8,10-13,15-16H,2,6-7,9H2,1H3,(H,24,25)(H,26,30);1H,(H,2,3)/t15-,16+;/m0./s1 |
| InChIKey | YYFBPFXCWGXKLJ-IDVLALEDSA-N |
| XLogP | 3.87 |
| TPSA | 147.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|