About 1H-pyrazolo[1,5-a][1,4]diazepine
1H-pyrazolo[1,5-a][1,4]diazepine (PubChem CID 122639030) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 1H-pyrazolo[1,5-a][1,4]diazepine.
Molecular Properties
| Compound Name | 1H-pyrazolo[1,5-a][1,4]diazepine |
| PubChem CID | 122639030 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 1H-pyrazolo[1,5-a][1,4]diazepine |
| SMILES | C1=CN2NC=CC2=CN=C1 |
| InChI | InChI=1S/C7H7N3/c1-3-8-6-7-2-4-9-10(7)5-1/h1-6,9H |
| InChIKey | PRXPEJJSKFNYFF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrazolo[1,5-a][1,4]diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazolo[1,5-a][1,4]diazepine?
The IUPAC name of 1H-pyrazolo[1,5-a][1,4]diazepine (CID 122639030) is 1H-pyrazolo[1,5-a][1,4]diazepine.
What is the SMILES notation for 1H-pyrazolo[1,5-a][1,4]diazepine?
The canonical SMILES for 1H-pyrazolo[1,5-a][1,4]diazepine is C1=CN2NC=CC2=CN=C1.
What is the InChIKey of 1H-pyrazolo[1,5-a][1,4]diazepine?
The InChIKey is PRXPEJJSKFNYFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c1-3-8-6-7-2-4-9-10(7)5-1/h1-6,9H.
What are the key properties of 1H-pyrazolo[1,5-a][1,4]diazepine?
1H-pyrazolo[1,5-a][1,4]diazepine has a molecular weight of 133.15 g/mol, XLogP of 0.76, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazolo[1,5-a][1,4]diazepine is sourced from PubChem (CID 122639030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).