C20H20ClFN4O3 — CID 122640594
5-amino-N-(4-chloro-2-fluorophenyl)-1-[2-(2-methoxyethoxy)phenyl]-3-methylpyrazole-4-carboxamide (PubChem CID 122640594) has the molecular formula C20H20ClFN4O3 and a molecular weight of 418.86 g/mol. Its IUPAC name is 5-amino-N-(4-chloro-2-fluorophenyl)-1-[2-(2-methoxyethoxy)phenyl]-3-methylpyrazole-4-carboxamide.
| Compound Name | 5-amino-N-(4-chloro-2-fluorophenyl)-1-[2-(2-methoxyethoxy)phenyl]-3-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 122640594 |
| Molecular Formula | C20H20ClFN4O3 |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 5-amino-N-(4-chloro-2-fluorophenyl)-1-[2-(2-methoxyethoxy)phenyl]-3-methylpyrazole-4-carboxamide |
| SMILES | COCCOc1ccccc1-n1nc(C)c(C(=O)Nc2ccc(Cl)cc2F)c1N |
| InChI | InChI=1S/C20H20ClFN4O3/c1-12-18(20(27)24-15-8-7-13(21)11-14(15)22)19(23)26(25-12)16-5-3-4-6-17(16)29-10-9-28-2/h3-8,11H,9-10,23H2,1-2H3,(H,24,27) |
| InChIKey | XAAQHXVLLIBCNZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|