C19H17ClF3N5O — CID 122640864
N-tert-butyl-3-(4-chlorophenyl)-5-[5-(trifluoromethyl)tetrazol-1-yl]benzamide (PubChem CID 122640864) has the molecular formula C19H17ClF3N5O and a molecular weight of 423.83 g/mol. Its IUPAC name is N-tert-butyl-3-(4-chlorophenyl)-5-[5-(trifluoromethyl)tetrazol-1-yl]benzamide.
| Compound Name | N-tert-butyl-3-(4-chlorophenyl)-5-[5-(trifluoromethyl)tetrazol-1-yl]benzamide |
|---|---|
| PubChem CID | 122640864 |
| Molecular Formula | C19H17ClF3N5O |
| Molecular Weight | 423.83 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-tert-butyl-3-(4-chlorophenyl)-5-[5-(trifluoromethyl)tetrazol-1-yl]benzamide |
| SMILES | CC(C)(C)NC(=O)c1cc(-c2ccc(Cl)cc2)cc(-n2nnnc2C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17ClF3N5O/c1-18(2,3)24-16(29)13-8-12(11-4-6-14(20)7-5-11)9-15(10-13)28-17(19(21,22)23)25-26-27-28/h4-10H,1-3H3,(H,24,29) |
| InChIKey | VRNKHHOWVWEITJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.83 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |