About [5-[4-[1-ethoxy-2-[methoxy(methyl)amino]-2-oxoethyl]phenyl]-1,3,4-thiadiazol-2-yl]methyl acetate
[5-[4-[1-ethoxy-2-[methoxy(methyl)amino]-2-oxoethyl]phenyl]-1,3,4-thiadiazol-2-yl]methyl acetate (PubChem CID 122641508) has the molecular formula C17H21N3O5S
and a molecular weight of 379.44 g/mol. Its IUPAC name is [5-[4-[1-ethoxy-2-[methoxy(methyl)amino]-2-oxoethyl]phenyl]-1,3,4-thiadiazol-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [5-[4-[1-ethoxy-2-[methoxy(methyl)amino]-2-oxoethyl]phenyl]-1,3,4-thiadiazol-2-yl]methyl acetate |
| PubChem CID | 122641508 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [5-[4-[1-ethoxy-2-[methoxy(methyl)amino]-2-oxoethyl]phenyl]-1,3,4-thiadiazol-2-yl]methyl acetate |
| SMILES | CCOC(C(=O)N(C)OC)c1ccc(-c2nnc(COC(C)=O)s2)cc1 |
| InChI | InChI=1S/C17H21N3O5S/c1-5-24-15(17(22)20(3)23-4)12-6-8-13(9-7-12)16-19-18-14(26-16)10-25-11(2)21/h6-9,15H,5,10H2,1-4H3 |
| InChIKey | HPKIQPLQDWPOJP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-[4-[1-ethoxy-2-[methoxy(methyl)amino]-2-oxoethyl]phenyl]-1,3,4-thiadiazol-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[4-[1-ethoxy-2-[methoxy(methyl)amino]-2-oxoethyl]phenyl]-1,3,4-thiadiazol-2-yl]methyl acetate?
The IUPAC name of [5-[4-[1-ethoxy-2-[methoxy(methyl)amino]-2-oxoethyl]phenyl]-1,3,4-thiadiazol-2-yl]methyl acetate (CID 122641508) is [5-[4-[1-ethoxy-2-[methoxy(methyl)amino]-2-oxoethyl]phenyl]-1,3,4-thiadiazol-2-yl]methyl acetate.
What is the SMILES notation for [5-[4-[1-ethoxy-2-[methoxy(methyl)amino]-2-oxoethyl]phenyl]-1,3,4-thiadiazol-2-yl]methyl acetate?
The canonical SMILES for [5-[4-[1-ethoxy-2-[methoxy(methyl)amino]-2-oxoethyl]phenyl]-1,3,4-thiadiazol-2-yl]methyl acetate is CCOC(C(=O)N(C)OC)c1ccc(-c2nnc(COC(C)=O)s2)cc1.
What is the InChIKey of [5-[4-[1-ethoxy-2-[methoxy(methyl)amino]-2-oxoethyl]phenyl]-1,3,4-thiadiazol-2-yl]methyl acetate?
The InChIKey is HPKIQPLQDWPOJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O5S/c1-5-24-15(17(22)20(3)23-4)12-6-8-13(9-7-12)16-19-18-14(26-16)10-25-11(2)21/h6-9,15H,5,10H2,1-4H3.
What are the key properties of [5-[4-[1-ethoxy-2-[methoxy(methyl)amino]-2-oxoethyl]phenyl]-1,3,4-thiadiazol-2-yl]methyl acetate?
[5-[4-[1-ethoxy-2-[methoxy(methyl)amino]-2-oxoethyl]phenyl]-1,3,4-thiadiazol-2-yl]methyl acetate has a molecular weight of 379.44 g/mol, XLogP of 2.37, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[4-[1-ethoxy-2-[methoxy(methyl)amino]-2-oxoethyl]phenyl]-1,3,4-thiadiazol-2-yl]methyl acetate is sourced from PubChem (CID 122641508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).