About (4R)-5,5-difluoro-4-methyl-4-(8-prop-1-ynyldibenzothiophen-2-yl)-6H-1,3-oxazin-2-amine
(4R)-5,5-difluoro-4-methyl-4-(8-prop-1-ynyldibenzothiophen-2-yl)-6H-1,3-oxazin-2-amine (PubChem CID 122641640) has the molecular formula C20H16F2N2OS
and a molecular weight of 370.42 g/mol. Its IUPAC name is (4R)-5,5-difluoro-4-methyl-4-(8-prop-1-ynyldibenzothiophen-2-yl)-6H-1,3-oxazin-2-amine.
Molecular Properties
| Compound Name | (4R)-5,5-difluoro-4-methyl-4-(8-prop-1-ynyldibenzothiophen-2-yl)-6H-1,3-oxazin-2-amine |
| PubChem CID | 122641640 |
| Molecular Formula | C20H16F2N2OS |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (4R)-5,5-difluoro-4-methyl-4-(8-prop-1-ynyldibenzothiophen-2-yl)-6H-1,3-oxazin-2-amine |
| SMILES | CC#Cc1ccc2sc3ccc([C@@]4(C)N=C(N)OCC4(F)F)cc3c2c1 |
| InChI | InChI=1S/C20H16F2N2OS/c1-3-4-12-5-7-16-14(9-12)15-10-13(6-8-17(15)26-16)19(2)20(21,22)11-25-18(23)24-19/h5-10H,11H2,1-2H3,(H2,23,24)/t19-/m1/s1 |
| InChIKey | YZFSPSBGKUKIIH-LJQANCHMSA-N |
| XLogP | 4.62 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4R)-5,5-difluoro-4-methyl-4-(8-prop-1-ynyldibenzothiophen-2-yl)-6H-1,3-oxazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-5,5-difluoro-4-methyl-4-(8-prop-1-ynyldibenzothiophen-2-yl)-6H-1,3-oxazin-2-amine?
The IUPAC name of (4R)-5,5-difluoro-4-methyl-4-(8-prop-1-ynyldibenzothiophen-2-yl)-6H-1,3-oxazin-2-amine (CID 122641640) is (4R)-5,5-difluoro-4-methyl-4-(8-prop-1-ynyldibenzothiophen-2-yl)-6H-1,3-oxazin-2-amine.
What is the SMILES notation for (4R)-5,5-difluoro-4-methyl-4-(8-prop-1-ynyldibenzothiophen-2-yl)-6H-1,3-oxazin-2-amine?
The canonical SMILES for (4R)-5,5-difluoro-4-methyl-4-(8-prop-1-ynyldibenzothiophen-2-yl)-6H-1,3-oxazin-2-amine is CC#Cc1ccc2sc3ccc([C@@]4(C)N=C(N)OCC4(F)F)cc3c2c1.
What is the InChIKey of (4R)-5,5-difluoro-4-methyl-4-(8-prop-1-ynyldibenzothiophen-2-yl)-6H-1,3-oxazin-2-amine?
The InChIKey is YZFSPSBGKUKIIH-LJQANCHMSA-N. The full InChI is InChI=1S/C20H16F2N2OS/c1-3-4-12-5-7-16-14(9-12)15-10-13(6-8-17(15)26-16)19(2)20(21,22)11-25-18(23)24-19/h5-10H,11H2,1-2H3,(H2,23,24)/t19-/m1/s1.
What are the key properties of (4R)-5,5-difluoro-4-methyl-4-(8-prop-1-ynyldibenzothiophen-2-yl)-6H-1,3-oxazin-2-amine?
(4R)-5,5-difluoro-4-methyl-4-(8-prop-1-ynyldibenzothiophen-2-yl)-6H-1,3-oxazin-2-amine has a molecular weight of 370.42 g/mol, XLogP of 4.62, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-5,5-difluoro-4-methyl-4-(8-prop-1-ynyldibenzothiophen-2-yl)-6H-1,3-oxazin-2-amine is sourced from PubChem (CID 122641640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).