C10H5Cl2F3N4O — CID 122641810
4-(2,6-dichlorophenoxy)-6-(trifluoromethyl)-1,3,5-triazin-2-amine (PubChem CID 122641810) has the molecular formula C10H5Cl2F3N4O and a molecular weight of 325.08 g/mol. Its IUPAC name is 4-(2,6-dichlorophenoxy)-6-(trifluoromethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,6-dichlorophenoxy)-6-(trifluoromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 122641810 |
| Molecular Formula | C10H5Cl2F3N4O |
| Molecular Weight | 325.08 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 4-(2,6-dichlorophenoxy)-6-(trifluoromethyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Oc2c(Cl)cccc2Cl)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H5Cl2F3N4O/c11-4-2-1-3-5(12)6(4)20-9-18-7(10(13,14)15)17-8(16)19-9/h1-3H,(H2,16,17,18,19) |
| InChIKey | XQXXUPOGJSMJFS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.08 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |