C16H13N7O2S — CID 122641867
2-(1-hydroxypyrazol-4-yl)-N-(1-methyl-3-pyridin-2-ylpyrazol-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 122641867) has the molecular formula C16H13N7O2S and a molecular weight of 367.39 g/mol. Its IUPAC name is 2-(1-hydroxypyrazol-4-yl)-N-(1-methyl-3-pyridin-2-ylpyrazol-4-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1-hydroxypyrazol-4-yl)-N-(1-methyl-3-pyridin-2-ylpyrazol-4-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 122641867 |
| Molecular Formula | C16H13N7O2S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-(1-hydroxypyrazol-4-yl)-N-(1-methyl-3-pyridin-2-ylpyrazol-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | Cn1cc(NC(=O)c2csc(-c3cnn(O)c3)n2)c(-c2ccccn2)n1 |
| InChI | InChI=1S/C16H13N7O2S/c1-22-8-12(14(21-22)11-4-2-3-5-17-11)19-15(24)13-9-26-16(20-13)10-6-18-23(25)7-10/h2-9,25H,1H3,(H,19,24) |
| InChIKey | VJUJVWGUBZVNFZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|