C24H23F3N4O — CID 122642365
5,7-dimethyl-2-[2,2,2-trifluoro-1-hydroxy-1-(1,5,6,7-tetramethylindol-4-yl)ethyl]-3H-pyrrolo[3,2-b]pyridine-6-carbonitrile (PubChem CID 122642365) has the molecular formula C24H23F3N4O and a molecular weight of 440.47 g/mol. Its IUPAC name is 5,7-dimethyl-2-[2,2,2-trifluoro-1-hydroxy-1-(1,5,6,7-tetramethylindol-4-yl)ethyl]-3H-pyrrolo[3,2-b]pyridine-6-carbonitrile.
| Compound Name | 5,7-dimethyl-2-[2,2,2-trifluoro-1-hydroxy-1-(1,5,6,7-tetramethylindol-4-yl)ethyl]-3H-pyrrolo[3,2-b]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 122642365 |
| Molecular Formula | C24H23F3N4O |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 5,7-dimethyl-2-[2,2,2-trifluoro-1-hydroxy-1-(1,5,6,7-tetramethylindol-4-yl)ethyl]-3H-pyrrolo[3,2-b]pyridine-6-carbonitrile |
| SMILES | Cc1nc2c(c(C)c1C#N)N=C(C(O)(c1c(C)c(C)c(C)c3c1ccn3C)C(F)(F)F)C2 |
| InChI | InChI=1S/C24H23F3N4O/c1-11-12(2)20(16-7-8-31(6)22(16)13(11)3)23(32,24(25,26)27)19-9-18-21(30-19)14(4)17(10-28)15(5)29-18/h7-8,32H,9H2,1-6H3 |
| InChIKey | REKNWVFPAOAGGD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |