About N-[(1R)-3,5-difluorocyclohexa-2,4-dien-1-yl]methanesulfonamide
N-[(1R)-3,5-difluorocyclohexa-2,4-dien-1-yl]methanesulfonamide (PubChem CID 122642776) has the molecular formula C7H9F2NO2S
and a molecular weight of 209.22 g/mol. Its IUPAC name is N-[(1R)-3,5-difluorocyclohexa-2,4-dien-1-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[(1R)-3,5-difluorocyclohexa-2,4-dien-1-yl]methanesulfonamide |
| PubChem CID | 122642776 |
| Molecular Formula | C7H9F2NO2S |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | N-[(1R)-3,5-difluorocyclohexa-2,4-dien-1-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@H]1C=C(F)C=C(F)C1 |
| InChI | InChI=1S/C7H9F2NO2S/c1-13(11,12)10-7-3-5(8)2-6(9)4-7/h2-3,7,10H,4H2,1H3/t7-/m0/s1 |
| InChIKey | LLEBBIIDWRYDSZ-ZETCQYMHSA-N |
| XLogP | 1.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1R)-3,5-difluorocyclohexa-2,4-dien-1-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-3,5-difluorocyclohexa-2,4-dien-1-yl]methanesulfonamide?
The IUPAC name of N-[(1R)-3,5-difluorocyclohexa-2,4-dien-1-yl]methanesulfonamide (CID 122642776) is N-[(1R)-3,5-difluorocyclohexa-2,4-dien-1-yl]methanesulfonamide.
What is the SMILES notation for N-[(1R)-3,5-difluorocyclohexa-2,4-dien-1-yl]methanesulfonamide?
The canonical SMILES for N-[(1R)-3,5-difluorocyclohexa-2,4-dien-1-yl]methanesulfonamide is CS(=O)(=O)N[C@H]1C=C(F)C=C(F)C1.
What is the InChIKey of N-[(1R)-3,5-difluorocyclohexa-2,4-dien-1-yl]methanesulfonamide?
The InChIKey is LLEBBIIDWRYDSZ-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H9F2NO2S/c1-13(11,12)10-7-3-5(8)2-6(9)4-7/h2-3,7,10H,4H2,1H3/t7-/m0/s1.
What are the key properties of N-[(1R)-3,5-difluorocyclohexa-2,4-dien-1-yl]methanesulfonamide?
N-[(1R)-3,5-difluorocyclohexa-2,4-dien-1-yl]methanesulfonamide has a molecular weight of 209.22 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-3,5-difluorocyclohexa-2,4-dien-1-yl]methanesulfonamide is sourced from PubChem (CID 122642776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).