C10H18FN — CID 122642786
1-ethyl-3-fluoro-4-propan-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 122642786) has the molecular formula C10H18FN and a molecular weight of 171.26 g/mol. Its IUPAC name is 1-ethyl-3-fluoro-4-propan-2-yl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-ethyl-3-fluoro-4-propan-2-yl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 122642786 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 1-ethyl-3-fluoro-4-propan-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | CCN1CC=C(C(C)C)C(F)C1 |
| InChI | InChI=1S/C10H18FN/c1-4-12-6-5-9(8(2)3)10(11)7-12/h5,8,10H,4,6-7H2,1-3H3 |
| InChIKey | OVPKYBCHFLPBAQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|