C14H22N6O2 — CID 122643117
N-imino-5,5-dimethyl-2-(oxan-4-ylamino)-7,7a-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxamide (PubChem CID 122643117) has the molecular formula C14H22N6O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-imino-5,5-dimethyl-2-(oxan-4-ylamino)-7,7a-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxamide.
| Compound Name | N-imino-5,5-dimethyl-2-(oxan-4-ylamino)-7,7a-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 122643117 |
| Molecular Formula | C14H22N6O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N-imino-5,5-dimethyl-2-(oxan-4-ylamino)-7,7a-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxamide |
| SMILES | [H]/N=N/C(=O)N1CC2N=C(NC3CCOCC3)NC=C2C1(C)C |
| InChI | InChI=1S/C14H22N6O2/c1-14(2)10-7-16-12(17-9-3-5-22-6-4-9)18-11(10)8-20(14)13(21)19-15/h7,9,11,15H,3-6,8H2,1-2H3,(H2,16,17,18)/b19-15+ |
| InChIKey | KEBDGMFIPFBEQA-XDJHFCHBSA-N |
| XLogP | 1.21 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|