C24H28N4O2 — CID 122643150
(4S)-1-[5,5-dimethyl-2-(oxan-4-ylamino)-7H-pyrrolo[3,4-d]pyrimidin-6-yl]-4-phenylpent-2-yn-1-one (PubChem CID 122643150) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (4S)-1-[5,5-dimethyl-2-(oxan-4-ylamino)-7H-pyrrolo[3,4-d]pyrimidin-6-yl]-4-phenylpent-2-yn-1-one.
| Compound Name | (4S)-1-[5,5-dimethyl-2-(oxan-4-ylamino)-7H-pyrrolo[3,4-d]pyrimidin-6-yl]-4-phenylpent-2-yn-1-one |
|---|---|
| PubChem CID | 122643150 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (4S)-1-[5,5-dimethyl-2-(oxan-4-ylamino)-7H-pyrrolo[3,4-d]pyrimidin-6-yl]-4-phenylpent-2-yn-1-one |
| SMILES | C[C@H](C#CC(=O)N1Cc2nc(NC3CCOCC3)ncc2C1(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H28N4O2/c1-17(18-7-5-4-6-8-18)9-10-22(29)28-16-21-20(24(28,2)3)15-25-23(27-21)26-19-11-13-30-14-12-19/h4-8,15,17,19H,11-14,16H2,1-3H3,(H,25,26,27)/t17-/m1/s1 |
| InChIKey | ZKGLSDSPNGBPGL-QGZVFWFLSA-N |
| XLogP | 3.45 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|